C23H20BrClN4O2 — CID 17202032
N'-[(E)-[5-bromo-2-(2-chloroanilino)phenyl]methylideneamino]-N-(4-ethylphenyl)oxamide (PubChem CID 17202032) has the molecular formula C23H20BrClN4O2 and a molecular weight of 499.80 g/mol. Its IUPAC name is N'-[(E)-[5-bromo-2-(2-chloroanilino)phenyl]methylideneamino]-N-(4-ethylphenyl)oxamide.
| Compound Name | N'-[(E)-[5-bromo-2-(2-chloroanilino)phenyl]methylideneamino]-N-(4-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 17202032 |
| Molecular Formula | C23H20BrClN4O2 |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | N'-[(E)-[5-bromo-2-(2-chloroanilino)phenyl]methylideneamino]-N-(4-ethylphenyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)N/N=C/c2cc(Br)ccc2Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H20BrClN4O2/c1-2-15-7-10-18(11-8-15)27-22(30)23(31)29-26-14-16-13-17(24)9-12-20(16)28-21-6-4-3-5-19(21)25/h3-14,28H,2H2,1H3,(H,27,30)(H,29,31)/b26-14+ |
| InChIKey | SFIQTQUXEUGIKC-VULFUBBASA-N |
| XLogP | 5.50 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|