C22H30N4O3 — CID 17214319
5-[[4-[[3-(2-hydroxyethylamino)propylamino]methyl]phenoxy]methyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 17214319) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 5-[[4-[[3-(2-hydroxyethylamino)propylamino]methyl]phenoxy]methyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[[4-[[3-(2-hydroxyethylamino)propylamino]methyl]phenoxy]methyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 17214319 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 5-[[4-[[3-(2-hydroxyethylamino)propylamino]methyl]phenoxy]methyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(COc3ccc(CNCCCNCCO)cc3)ccc21 |
| InChI | InChI=1S/C22H30N4O3/c1-25-20-9-6-18(14-21(20)26(2)22(25)28)16-29-19-7-4-17(5-8-19)15-24-11-3-10-23-12-13-27/h4-9,14,23-24,27H,3,10-13,15-16H2,1-2H3 |
| InChIKey | HVBFYGHLHWBNPF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|