C21H29BrN2O3 — CID 17214327
2-[3-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propylamino]ethanol (PubChem CID 17214327) has the molecular formula C21H29BrN2O3 and a molecular weight of 437.38 g/mol. Its IUPAC name is 2-[3-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propylamino]ethanol.
| Compound Name | 2-[3-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propylamino]ethanol |
|---|---|
| PubChem CID | 17214327 |
| Molecular Formula | C21H29BrN2O3 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[3-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propylamino]ethanol |
| SMILES | COc1cc(CNCCCNCCO)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C21H29BrN2O3/c1-16-4-6-17(7-5-16)15-27-21-19(22)12-18(13-20(21)26-2)14-24-9-3-8-23-10-11-25/h4-7,12-13,23-25H,3,8-11,14-15H2,1-2H3 |
| InChIKey | CKLJXSVBLMDOQS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|