C21H23Br2NO2 — CID 17216905
3-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]adamantan-1-ol (PubChem CID 17216905) has the molecular formula C21H23Br2NO2 and a molecular weight of 481.23 g/mol. Its IUPAC name is 3-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]adamantan-1-ol.
| Compound Name | 3-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]adamantan-1-ol |
|---|---|
| PubChem CID | 17216905 |
| Molecular Formula | C21H23Br2NO2 |
| Molecular Weight | 481.23 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 3-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]adamantan-1-ol |
| SMILES | OC12CC3CC(C1)CC(NCc1ccc(-c4ccc(Br)cc4Br)o1)(C3)C2 |
| InChI | InChI=1S/C21H23Br2NO2/c22-15-1-3-17(18(23)6-15)19-4-2-16(26-19)11-24-20-7-13-5-14(8-20)10-21(25,9-13)12-20/h1-4,6,13-14,24-25H,5,7-12H2 |
| InChIKey | JIHVBIJXQNBMCF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.23 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |