C19H12F5N5OS — CID 17219531
2,3,4,5,6-pentafluoro-N-[3-(3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide (PubChem CID 17219531) has the molecular formula C19H12F5N5OS and a molecular weight of 453.40 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-(3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-(3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17219531 |
| Molecular Formula | C19H12F5N5OS |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-(3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
| SMILES | CCCc1nnc2sc(-c3cccc(NC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)nn12 |
| InChI | InChI=1S/C19H12F5N5OS/c1-2-4-10-26-27-19-29(10)28-18(31-19)8-5-3-6-9(7-8)25-17(30)11-12(20)14(22)16(24)15(23)13(11)21/h3,5-7H,2,4H2,1H3,(H,25,30) |
| InChIKey | VQXBJWQPZQIOLP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|