C11H18N2O2S2 — CID 17221119
[3-(4-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanamine (PubChem CID 17221119) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is [3-(4-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanamine.
| Compound Name | [3-(4-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 17221119 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [3-(4-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanamine |
| SMILES | CC1CCN(S(=O)(=O)c2ccsc2CN)CC1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-9-2-5-13(6-3-9)17(14,15)11-4-7-16-10(11)8-12/h4,7,9H,2-3,5-6,8,12H2,1H3 |
| InChIKey | OFSBBBIAJPGHPY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |