C20H27ClN2O2 — CID 17223347
[1-(2-chlorobenzoyl)piperidin-4-yl]-(2-ethylpiperidin-1-yl)methanone (PubChem CID 17223347) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is [1-(2-chlorobenzoyl)piperidin-4-yl]-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | [1-(2-chlorobenzoyl)piperidin-4-yl]-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 17223347 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [1-(2-chlorobenzoyl)piperidin-4-yl]-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)C1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H27ClN2O2/c1-2-16-7-5-6-12-23(16)19(24)15-10-13-22(14-11-15)20(25)17-8-3-4-9-18(17)21/h3-4,8-9,15-16H,2,5-7,10-14H2,1H3 |
| InChIKey | LJNJKUQFTYSOTR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |