C18H26N2O2S — CID 27244606
[(2R)-2-ethylpiperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone (PubChem CID 27244606) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is [(2R)-2-ethylpiperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone.
| Compound Name | [(2R)-2-ethylpiperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 27244606 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [(2R)-2-ethylpiperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H26N2O2S/c1-2-15-6-3-4-10-20(15)17(21)14-8-11-19(12-9-14)18(22)16-7-5-13-23-16/h5,7,13-15H,2-4,6,8-12H2,1H3/t15-/m1/s1 |
| InChIKey | LMGWYLANNXVLJJ-OAHLLOKOSA-N |
| XLogP | 3.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |