C19H26N2O3S — CID 55806549
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone (PubChem CID 55806549) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55806549 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1cccs1)N1CCC(C(=O)N2CCOC3CCCCC32)CC1 |
| InChI | InChI=1S/C19H26N2O3S/c22-18(21-11-12-24-16-5-2-1-4-15(16)21)14-7-9-20(10-8-14)19(23)17-6-3-13-25-17/h3,6,13-16H,1-2,4-5,7-12H2 |
| InChIKey | LFSOZVJCKUELPZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |