C18H23N7 — CID 17229349
3-cycloheptyl-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole (PubChem CID 17229349) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is 3-cycloheptyl-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole.
| Compound Name | 3-cycloheptyl-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 17229349 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-cycloheptyl-1-(1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole |
| SMILES | c1ccc2c(c1)nc1n2CN(C2CCCCCC2)CN1n1cnnc1 |
| InChI | InChI=1S/C18H23N7/c1-2-4-8-15(7-3-1)22-13-24-17-10-6-5-9-16(17)21-18(24)25(14-22)23-11-19-20-12-23/h5-6,9-12,15H,1-4,7-8,13-14H2 |
| InChIKey | FBWNCYVXDXMCHI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |