C23H25NO3 — CID 17238472
2-methoxy-6-[8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol (PubChem CID 17238472) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-methoxy-6-[8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol.
| Compound Name | 2-methoxy-6-[8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol |
|---|---|
| PubChem CID | 17238472 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-methoxy-6-[8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenol |
| SMILES | C=C(C)COc1ccc2c(c1)C1C=CCC1C(c1cccc(OC)c1O)N2 |
| InChI | InChI=1S/C23H25NO3/c1-14(2)13-27-15-10-11-20-19(12-15)16-6-4-7-17(16)22(24-20)18-8-5-9-21(26-3)23(18)25/h4-6,8-12,16-17,22,24-25H,1,7,13H2,2-3H3 |
| InChIKey | BCKZKSLUZXJKKD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|