C22H21Cl2NO — CID 17243079
4-(2,6-dichlorophenyl)-8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17243079) has the molecular formula C22H21Cl2NO and a molecular weight of 386.32 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,6-dichlorophenyl)-8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17243079 |
| Molecular Formula | C22H21Cl2NO |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-8-(2-methylprop-2-enoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | C=C(C)COc1ccc2c(c1)C1C=CCC1C(c1c(Cl)cccc1Cl)N2 |
| InChI | InChI=1S/C22H21Cl2NO/c1-13(2)12-26-14-9-10-20-17(11-14)15-5-3-6-16(15)22(25-20)21-18(23)7-4-8-19(21)24/h3-5,7-11,15-16,22,25H,1,6,12H2,2H3 |
| InChIKey | QWGLQHSAJJCTNH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|