C21H21Cl2NO — CID 17243074
4-(2,6-dichlorophenyl)-8-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17243074) has the molecular formula C21H21Cl2NO and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-8-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,6-dichlorophenyl)-8-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17243074 |
| Molecular Formula | C21H21Cl2NO |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-8-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CC(C)Oc1ccc2c(c1)C1C=CCC1C(c1c(Cl)cccc1Cl)N2 |
| InChI | InChI=1S/C21H21Cl2NO/c1-12(2)25-13-9-10-19-16(11-13)14-5-3-6-15(14)21(24-19)20-17(22)7-4-8-18(20)23/h3-5,7-12,14-15,21,24H,6H2,1-2H3 |
| InChIKey | AGNIRPNSRUWWHS-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|