C24H21NO3 — CID 17243343
methyl 4-(2-hydroxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate (PubChem CID 17243343) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 4-(2-hydroxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate.
| Compound Name | methyl 4-(2-hydroxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 17243343 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl 4-(2-hydroxynaphthalen-1-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate |
| SMILES | COC(=O)c1cccc2c1NC(c1c(O)ccc3ccccc13)C1CC=CC21 |
| InChI | InChI=1S/C24H21NO3/c1-28-24(27)19-11-5-9-17-16-8-4-10-18(16)23(25-22(17)19)21-15-7-3-2-6-14(15)12-13-20(21)26/h2-9,11-13,16,18,23,25-26H,10H2,1H3 |
| InChIKey | WZFHFKGXLLDQRZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|