C22H24N2O2S — CID 17243533
N-(oxolan-2-ylmethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17243533) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17243533 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-thiophen-2-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cccc2c1NC(c1cccs1)C1CC=CC21 |
| InChI | InChI=1S/C22H24N2O2S/c25-22(23-13-14-5-3-11-26-14)18-9-2-7-16-15-6-1-8-17(15)21(24-20(16)18)19-10-4-12-27-19/h1-2,4,6-7,9-10,12,14-15,17,21,24H,3,5,8,11,13H2,(H,23,25) |
| InChIKey | IBHPJDXKMCOVOB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|