C31H27BrN2O3S2 — CID 17246960
N,N-dibenzyl-5-[(4-bromophenyl)sulfonyl-ethylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17246960) has the molecular formula C31H27BrN2O3S2 and a molecular weight of 619.61 g/mol. Its IUPAC name is N,N-dibenzyl-5-[(4-bromophenyl)sulfonyl-ethylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N,N-dibenzyl-5-[(4-bromophenyl)sulfonyl-ethylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17246960 |
| Molecular Formula | C31H27BrN2O3S2 |
| Molecular Weight | 619.61 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | N,N-dibenzyl-5-[(4-bromophenyl)sulfonyl-ethylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(c1ccc2sc(C(=O)N(Cc3ccccc3)Cc3ccccc3)cc2c1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H27BrN2O3S2/c1-2-34(39(36,37)28-16-13-26(32)14-17-28)27-15-18-29-25(19-27)20-30(38-29)31(35)33(21-23-9-5-3-6-10-23)22-24-11-7-4-8-12-24/h3-20H,2,21-22H2,1H3 |
| InChIKey | ZDXRKCMHBBOECJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.61 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |