C21H24N2O3S2 — CID 50810583
5-[ethyl-(4-methylphenyl)sulfonylamino]-N-propan-2-yl-1-benzothiophene-2-carboxamide (PubChem CID 50810583) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 5-[ethyl-(4-methylphenyl)sulfonylamino]-N-propan-2-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 5-[ethyl-(4-methylphenyl)sulfonylamino]-N-propan-2-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 50810583 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[ethyl-(4-methylphenyl)sulfonylamino]-N-propan-2-yl-1-benzothiophene-2-carboxamide |
| SMILES | CCN(c1ccc2sc(C(=O)NC(C)C)cc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-5-23(28(25,26)18-9-6-15(4)7-10-18)17-8-11-19-16(12-17)13-20(27-19)21(24)22-14(2)3/h6-14H,5H2,1-4H3,(H,22,24) |
| InChIKey | ZVBKBJLDBZAVEJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |