C25H21N3O3S2 — CID 100767549
N-(3-cyanophenyl)-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide (PubChem CID 100767549) has the molecular formula C25H21N3O3S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-cyanophenyl)-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 100767549 |
| Molecular Formula | C25H21N3O3S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-(3-cyanophenyl)-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(c1ccc2sc(C(=O)Nc3cccc(C#N)c3)cc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H21N3O3S2/c1-3-28(33(30,31)22-10-7-17(2)8-11-22)21-9-12-23-19(14-21)15-24(32-23)25(29)27-20-6-4-5-18(13-20)16-26/h4-15H,3H2,1-2H3,(H,27,29) |
| InChIKey | OYUYNZOVCKSIBL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |