C26H32N2O3S2 — CID 100768168
N-cyclooctyl-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide (PubChem CID 100768168) has the molecular formula C26H32N2O3S2 and a molecular weight of 484.69 g/mol. Its IUPAC name is N-cyclooctyl-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-cyclooctyl-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 100768168 |
| Molecular Formula | C26H32N2O3S2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-cyclooctyl-5-[ethyl-(4-methylphenyl)sulfonylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(c1ccc2sc(C(=O)NC3CCCCCCC3)cc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N2O3S2/c1-3-28(33(30,31)23-14-11-19(2)12-15-23)22-13-16-24-20(17-22)18-25(32-24)26(29)27-21-9-7-5-4-6-8-10-21/h11-18,21H,3-10H2,1-2H3,(H,27,29) |
| InChIKey | HETJSCVWWGBRPX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |