C24H21IN2O3S2 — CID 100767829
5-[ethyl-(4-methylphenyl)sulfonylamino]-N-(4-iodophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 100767829) has the molecular formula C24H21IN2O3S2 and a molecular weight of 576.48 g/mol. Its IUPAC name is 5-[ethyl-(4-methylphenyl)sulfonylamino]-N-(4-iodophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-[ethyl-(4-methylphenyl)sulfonylamino]-N-(4-iodophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 100767829 |
| Molecular Formula | C24H21IN2O3S2 |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 576.00 |
| IUPAC Name | 5-[ethyl-(4-methylphenyl)sulfonylamino]-N-(4-iodophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCN(c1ccc2sc(C(=O)Nc3ccc(I)cc3)cc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H21IN2O3S2/c1-3-27(32(29,30)21-11-4-16(2)5-12-21)20-10-13-22-17(14-20)15-23(31-22)24(28)26-19-8-6-18(25)7-9-19/h4-15H,3H2,1-2H3,(H,26,28) |
| InChIKey | QCQACAIJPALXBJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|