C18H21ClN2O3 — CID 17249616
2-(4-chloro-3-methylphenoxy)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 17249616) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17249616 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(OCC(=O)N2CCN(Cc3ccco3)CC2)ccc1Cl |
| InChI | InChI=1S/C18H21ClN2O3/c1-14-11-15(4-5-17(14)19)24-13-18(22)21-8-6-20(7-9-21)12-16-3-2-10-23-16/h2-5,10-11H,6-9,12-13H2,1H3 |
| InChIKey | LLGANQQXTFTADJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |