C30H30N4O4 — CID 172515375
[1-[[4-[2-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]methyl]piperidin-4-yl] formate (PubChem CID 172515375) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is [1-[[4-[2-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]methyl]piperidin-4-yl] formate.
| Compound Name | [1-[[4-[2-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]methyl]piperidin-4-yl] formate |
|---|---|
| PubChem CID | 172515375 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | [1-[[4-[2-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]methyl]piperidin-4-yl] formate |
| SMILES | C[C@H](O)c1nccn1Cc1cc(-c2ccc(C#Cc3ccc(CN4CCC(OC=O)CC4)cc3)cc2)on1 |
| InChI | InChI=1S/C30H30N4O4/c1-22(36)30-31-14-17-34(30)20-27-18-29(38-32-27)26-10-8-24(9-11-26)3-2-23-4-6-25(7-5-23)19-33-15-12-28(13-16-33)37-21-35/h4-11,14,17-18,21-22,28,36H,12-13,15-16,19-20H2,1H3/t22-/m0/s1 |
| InChIKey | YITVERCFCQZYFS-QFIPXVFZSA-N |
| XLogP | 4.18 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|