C28H32N2 — CID 172515546
5-(cyclopropylmethyl)-7-methyl-4-[[(2S,4R)-2-phenyl-4-prop-2-ynylpiperidin-1-yl]methyl]-1H-indole (PubChem CID 172515546) has the molecular formula C28H32N2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-7-methyl-4-[[(2S,4R)-2-phenyl-4-prop-2-ynylpiperidin-1-yl]methyl]-1H-indole.
| Compound Name | 5-(cyclopropylmethyl)-7-methyl-4-[[(2S,4R)-2-phenyl-4-prop-2-ynylpiperidin-1-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 172515546 |
| Molecular Formula | C28H32N2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 5-(cyclopropylmethyl)-7-methyl-4-[[(2S,4R)-2-phenyl-4-prop-2-ynylpiperidin-1-yl]methyl]-1H-indole |
| SMILES | C#CC[C@@H]1CCN(Cc2c(CC3CC3)cc(C)c3[nH]ccc23)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C28H32N2/c1-3-7-21-13-15-30(27(18-21)23-8-5-4-6-9-23)19-26-24(17-22-10-11-22)16-20(2)28-25(26)12-14-29-28/h1,4-6,8-9,12,14,16,21-22,27,29H,7,10-11,13,15,17-19H2,2H3/t21-,27+/m1/s1 |
| InChIKey | OWHQQBVKTXWVBW-ZBLYBZFDSA-N |
| XLogP | 6.41 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|