C30H53NO7S — CID 172517685
2-[4-(6-ethyl-3,7-dihydroxy-10,12,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-3-hydroxypropane-1-sulfonic acid (PubChem CID 172517685) has the molecular formula C30H53NO7S and a molecular weight of 571.82 g/mol. Its IUPAC name is 2-[4-(6-ethyl-3,7-dihydroxy-10,12,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-3-hydroxypropane-1-sulfonic acid.
| Compound Name | 2-[4-(6-ethyl-3,7-dihydroxy-10,12,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-3-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 172517685 |
| Molecular Formula | C30H53NO7S |
| Molecular Weight | 571.82 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | 2-[4-(6-ethyl-3,7-dihydroxy-10,12,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-3-hydroxypropane-1-sulfonic acid |
| SMILES | CCC1C(O)C2C(CC(C)C3(C)C(C(C)CCC(=O)NC(CO)CS(=O)(=O)O)CCC23)C2(C)CCC(O)CC12 |
| InChI | InChI=1S/C30H53NO7S/c1-6-21-24-14-20(33)11-12-29(24,4)25-13-18(3)30(5)22(8-9-23(30)27(25)28(21)35)17(2)7-10-26(34)31-19(15-32)16-39(36,37)38/h17-25,27-28,32-33,35H,6-16H2,1-5H3,(H,31,34)(H,36,37,38) |
| InChIKey | OKTGLXXJGXKTQK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|