C28H33IO7 — CID 172518349
methyl 5-ethenyl-2-[2-[2-(1-ethylcyclohexyl)oxycarbonyl-5-iodophenoxy]ethoxymethoxy]benzoate (PubChem CID 172518349) has the molecular formula C28H33IO7 and a molecular weight of 608.47 g/mol. Its IUPAC name is methyl 5-ethenyl-2-[2-[2-(1-ethylcyclohexyl)oxycarbonyl-5-iodophenoxy]ethoxymethoxy]benzoate.
| Compound Name | methyl 5-ethenyl-2-[2-[2-(1-ethylcyclohexyl)oxycarbonyl-5-iodophenoxy]ethoxymethoxy]benzoate |
|---|---|
| PubChem CID | 172518349 |
| Molecular Formula | C28H33IO7 |
| Molecular Weight | 608.47 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | methyl 5-ethenyl-2-[2-[2-(1-ethylcyclohexyl)oxycarbonyl-5-iodophenoxy]ethoxymethoxy]benzoate |
| SMILES | C=Cc1ccc(OCOCCOc2cc(I)ccc2C(=O)OC2(CC)CCCCC2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C28H33IO7/c1-4-20-9-12-24(23(17-20)26(30)32-3)35-19-33-15-16-34-25-18-21(29)10-11-22(25)27(31)36-28(5-2)13-7-6-8-14-28/h4,9-12,17-18H,1,5-8,13-16,19H2,2-3H3 |
| InChIKey | DYDXFARACMYZQR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|