C18H23IO4 — CID 172518364
(1-ethylcyclopentyl) 4-(2-ethenoxyethoxy)-3-iodobenzoate (PubChem CID 172518364) has the molecular formula C18H23IO4 and a molecular weight of 430.28 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 4-(2-ethenoxyethoxy)-3-iodobenzoate.
| Compound Name | (1-ethylcyclopentyl) 4-(2-ethenoxyethoxy)-3-iodobenzoate |
|---|---|
| PubChem CID | 172518364 |
| Molecular Formula | C18H23IO4 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (1-ethylcyclopentyl) 4-(2-ethenoxyethoxy)-3-iodobenzoate |
| SMILES | C=COCCOc1ccc(C(=O)OC2(CC)CCCC2)cc1I |
| InChI | InChI=1S/C18H23IO4/c1-3-18(9-5-6-10-18)23-17(20)14-7-8-16(15(19)13-14)22-12-11-21-4-2/h4,7-8,13H,2-3,5-6,9-12H2,1H3 |
| InChIKey | FGGOKZIWNKKZPG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|