C27H44O2 — CID 123675780
(1-ethylcyclohexyl) 3-(5-ethyl-2,2,5-trimethylheptan-4-yl)benzoate (PubChem CID 123675780) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 3-(5-ethyl-2,2,5-trimethylheptan-4-yl)benzoate.
| Compound Name | (1-ethylcyclohexyl) 3-(5-ethyl-2,2,5-trimethylheptan-4-yl)benzoate |
|---|---|
| PubChem CID | 123675780 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (1-ethylcyclohexyl) 3-(5-ethyl-2,2,5-trimethylheptan-4-yl)benzoate |
| SMILES | CCC1(OC(=O)c2cccc(C(CC(C)(C)C)C(C)(CC)CC)c2)CCCCC1 |
| InChI | InChI=1S/C27H44O2/c1-8-26(7,9-2)23(20-25(4,5)6)21-15-14-16-22(19-21)24(28)29-27(10-3)17-12-11-13-18-27/h14-16,19,23H,8-13,17-18,20H2,1-7H3 |
| InChIKey | MWYSQEFCWGZYTO-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |