C15H18F2O8S2 — CID 126604209
(1-ethylcyclohexyl) 3,5-bis(fluorosulfonyloxy)benzoate (PubChem CID 126604209) has the molecular formula C15H18F2O8S2 and a molecular weight of 428.43 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 3,5-bis(fluorosulfonyloxy)benzoate.
| Compound Name | (1-ethylcyclohexyl) 3,5-bis(fluorosulfonyloxy)benzoate |
|---|---|
| PubChem CID | 126604209 |
| Molecular Formula | C15H18F2O8S2 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | (1-ethylcyclohexyl) 3,5-bis(fluorosulfonyloxy)benzoate |
| SMILES | CCC1(OC(=O)c2cc(OS(=O)(=O)F)cc(OS(=O)(=O)F)c2)CCCCC1 |
| InChI | InChI=1S/C15H18F2O8S2/c1-2-15(6-4-3-5-7-15)23-14(18)11-8-12(24-26(16,19)20)10-13(9-11)25-27(17,21)22/h8-10H,2-7H2,1H3 |
| InChIKey | PVCYASZREGHKDS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |