C26H34O2 — CID 123753086
(1-ethylcyclopentyl) 6-(2,5-dimethylhex-1-en-3-yl)naphthalene-2-carboxylate (PubChem CID 123753086) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 6-(2,5-dimethylhex-1-en-3-yl)naphthalene-2-carboxylate.
| Compound Name | (1-ethylcyclopentyl) 6-(2,5-dimethylhex-1-en-3-yl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 123753086 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (1-ethylcyclopentyl) 6-(2,5-dimethylhex-1-en-3-yl)naphthalene-2-carboxylate |
| SMILES | C=C(C)C(CC(C)C)c1ccc2cc(C(=O)OC3(CC)CCCC3)ccc2c1 |
| InChI | InChI=1S/C26H34O2/c1-6-26(13-7-8-14-26)28-25(27)23-12-10-20-16-22(11-9-21(20)17-23)24(19(4)5)15-18(2)3/h9-12,16-18,24H,4,6-8,13-15H2,1-3,5H3 |
| InChIKey | IGGFVHDTEAXLSS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|