C56H39N — CID 172527119
N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]naphthalen-2-amine (PubChem CID 172527119) has the molecular formula C56H39N and a molecular weight of 733.98 g/mol. Its IUPAC name is N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]naphthalen-2-amine.
| Compound Name | N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 172527119 |
| Molecular Formula | C56H39N |
| Molecular Weight | 733.98 g/mol |
| Exact Mass | 733.36 |
| IUPAC Name | N-[2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]naphthalen-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3ccccc3c2)c2c([2H])c([2H])c(-c3ccc4ccccc4c3-c3ccccc3)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C56H39N/c1-4-15-42(16-5-1)52-36-30-48(39-55(52)43-17-6-2-7-18-43)41-24-31-49(32-25-41)57(51-35-26-40-14-10-11-22-47(40)38-51)50-33-27-45(28-34-50)54-37-29-44-19-12-13-23-53(44)56(54)46-20-8-3-9-21-46/h1-39H/i24D,25D,27D,28D,31D,32D,33D,34D |
| InChIKey | GFLBXPBYXKGDGG-APIBUWGVSA-N |
| XLogP | 15.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.98 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |