C66H45N — CID 172527754
2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)-N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline (PubChem CID 172527754) has the molecular formula C66H45N and a molecular weight of 860.14 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)-N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)-N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 172527754 |
| Molecular Formula | C66H45N |
| Molecular Weight | 860.14 g/mol |
| Exact Mass | 859.41 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(3,4-diphenylphenyl)-N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2-phenylnaphthalen-1-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cc4ccccc4c4ccccc34)cc2)c2c([2H])c([2H])c(-c3c(-c4ccccc4)ccc4ccccc34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C66H45N/c1-4-16-47(17-5-1)59-42-35-53(44-64(59)49-20-8-3-9-21-49)46-28-36-55(37-29-46)67(56-38-30-51(31-39-56)65-45-54-23-11-12-24-58(54)62-26-14-15-27-63(62)65)57-40-32-52(33-41-57)66-60-25-13-10-22-50(60)34-43-61(66)48-18-6-2-7-19-48/h1-45H/i28D,29D,32D,33D,36D,37D,40D,41D |
| InChIKey | FZXMSKHMDBYETG-JZLJWIDBSA-N |
| XLogP | 18.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.14 |
| LogP ≤ 5 | 18.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|