C64H45N — CID 172527823
2,3,5,6-tetradeuterio-4-(3,5-diphenylphenyl)-N-[4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline (PubChem CID 172527823) has the molecular formula C64H45N and a molecular weight of 835.11 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(3,5-diphenylphenyl)-N-[4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(3,5-diphenylphenyl)-N-[4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline |
|---|---|
| PubChem CID | 172527823 |
| Molecular Formula | C64H45N |
| Molecular Weight | 835.11 g/mol |
| Exact Mass | 834.40 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(3,5-diphenylphenyl)-N-[4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc4ccccc4c3-c3ccccc3)cc2)c2c([2H])c([2H])c(-c3ccccc3)c([2H])c2-c2ccccc2)c([2H])c([2H])c1-c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C64H45N/c1-6-18-46(19-7-1)54-35-41-63(62(45-54)50-24-12-4-13-25-50)65(59-38-32-52(33-39-59)61-40-34-51-26-16-17-29-60(51)64(61)53-27-14-5-15-28-53)58-36-30-49(31-37-58)57-43-55(47-20-8-2-9-21-47)42-56(44-57)48-22-10-3-11-23-48/h1-45H/i30D,31D,35D,36D,37D,41D,45D |
| InChIKey | HEHGGKMCKPOLAJ-HRFOUXHSSA-N |
| XLogP | 17.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.11 |
| LogP ≤ 5 | 17.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |