C60H41N — CID 172527916
2,3,5,6-tetradeuterio-4-phenanthren-9-yl-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline (PubChem CID 172527916) has the molecular formula C60H41N and a molecular weight of 783.04 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-phenanthren-9-yl-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-phenanthren-9-yl-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline |
|---|---|
| PubChem CID | 172527916 |
| Molecular Formula | C60H41N |
| Molecular Weight | 783.04 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-phenanthren-9-yl-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3c(-c4ccccc4)ccc4ccccc34)cc2)c2c([2H])c([2H])c(-c3cc4ccccc4c4ccccc34)c([2H])c2[2H])c(-c2ccccc2)c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C60H41N/c1-4-16-42(17-5-1)48-33-39-59(58(40-48)44-20-8-3-9-21-44)61(50-34-28-46(29-35-50)57-41-49-23-11-12-24-52(49)55-26-14-15-27-56(55)57)51-36-30-47(31-37-51)60-53-25-13-10-22-45(53)32-38-54(60)43-18-6-2-7-19-43/h1-41H/i28D,29D,33D,34D,35D,39D,40D |
| InChIKey | MZCVTYSYPNKJRA-HZNRXUJBSA-N |
| XLogP | 16.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.04 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|