C56H39N — CID 172527859
2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline (PubChem CID 172527859) has the molecular formula C56H39N and a molecular weight of 737.00 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline |
|---|---|
| PubChem CID | 172527859 |
| Molecular Formula | C56H39N |
| Molecular Weight | 737.00 g/mol |
| Exact Mass | 736.38 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-naphthalen-1-yl-N-[2,3,5,6-tetradeuterio-4-(1-phenylnaphthalen-2-yl)phenyl]-N-(2,3,5-trideuterio-4,6-diphenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2c([2H])c([2H])c(-c3ccc4ccccc4c3-c3ccccc3)c([2H])c2[2H])c2c([2H])c([2H])c(-c3ccccc3)c([2H])c2-c2ccccc2)c1[2H] |
| InChI | InChI=1S/C56H39N/c1-4-16-40(17-5-1)46-33-37-55(54(39-46)42-18-6-2-7-19-42)57(49-26-14-25-47(38-49)51-29-15-24-41-20-10-12-27-50(41)51)48-34-30-44(31-35-48)53-36-32-43-21-11-13-28-52(43)56(53)45-22-8-3-9-23-45/h1-39H/i14D,25D,26D,30D,31D,33D,34D,35D,37D,38D,39D |
| InChIKey | NMJNVMWCHPKKMQ-GLLVTYKBSA-N |
| XLogP | 15.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.00 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |