C17H26N3O5+ — CID 172533746
methyl 1-hydroxy-2-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]pyridin-1-ium-3-carboxylate (PubChem CID 172533746) has the molecular formula C17H26N3O5+ and a molecular weight of 352.41 g/mol. Its IUPAC name is methyl 1-hydroxy-2-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]pyridin-1-ium-3-carboxylate.
| Compound Name | methyl 1-hydroxy-2-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 172533746 |
| Molecular Formula | C17H26N3O5+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | methyl 1-hydroxy-2-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]pyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1ccc[n+](O)c1N[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H25N3O5/c1-17(2,3)25-16(22)19-9-5-7-12(11-19)18-14-13(15(21)24-4)8-6-10-20(14)23/h6,8,10,12,23H,5,7,9,11H2,1-4H3/p+1/t12-/m1/s1 |
| InChIKey | RRLVFSXOQJRINW-GFCCVEGCSA-O |
| XLogP | 1.81 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|