C25H27F3N4O2S2 — CID 172535424
N'-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]benzenesulfonohydrazide (PubChem CID 172535424) has the molecular formula C25H27F3N4O2S2 and a molecular weight of 536.65 g/mol. Its IUPAC name is N'-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]benzenesulfonohydrazide.
| Compound Name | N'-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 172535424 |
| Molecular Formula | C25H27F3N4O2S2 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | N'-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]benzenesulfonohydrazide |
| SMILES | CN1CCC(Nc2cccc3c(CC(F)(F)F)c(C#CCNNS(=O)(=O)c4ccccc4)sc23)CC1 |
| InChI | InChI=1S/C25H27F3N4O2S2/c1-32-15-12-18(13-16-32)30-22-10-5-9-20-21(17-25(26,27)28)23(35-24(20)22)11-6-14-29-31-36(33,34)19-7-3-2-4-8-19/h2-5,7-10,18,29-31H,12-17H2,1H3 |
| InChIKey | VZYXNMFYMJQDKP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|