C28H29F3N4O2S2 — CID 177255397
1-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]-4-methylsulfonylindol-7-amine (PubChem CID 177255397) has the molecular formula C28H29F3N4O2S2 and a molecular weight of 574.69 g/mol. Its IUPAC name is 1-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]-4-methylsulfonylindol-7-amine.
| Compound Name | 1-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]-4-methylsulfonylindol-7-amine |
|---|---|
| PubChem CID | 177255397 |
| Molecular Formula | C28H29F3N4O2S2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 1-[3-[7-[(1-methylpiperidin-4-yl)amino]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynyl]-4-methylsulfonylindol-7-amine |
| SMILES | CN1CCC(Nc2cccc3c(CC(F)(F)F)c(C#CCn4ccc5c(S(C)(=O)=O)ccc(N)c54)sc23)CC1 |
| InChI | InChI=1S/C28H29F3N4O2S2/c1-34-14-10-18(11-15-34)33-23-6-3-5-19-21(17-28(29,30)31)24(38-27(19)23)7-4-13-35-16-12-20-25(39(2,36)37)9-8-22(32)26(20)35/h3,5-6,8-9,12,16,18,33H,10-11,13-15,17,32H2,1-2H3 |
| InChIKey | RGKOQLKOWCDJQA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|