C25H25F3N3OPS — CID 175558238
1-methyl-N-[2-[3-(4-phosphorosoanilino)prop-1-ynyl]-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine (PubChem CID 175558238) has the molecular formula C25H25F3N3OPS and a molecular weight of 503.53 g/mol. Its IUPAC name is 1-methyl-N-[2-[3-(4-phosphorosoanilino)prop-1-ynyl]-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine.
| Compound Name | 1-methyl-N-[2-[3-(4-phosphorosoanilino)prop-1-ynyl]-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 175558238 |
| Molecular Formula | C25H25F3N3OPS |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 1-methyl-N-[2-[3-(4-phosphorosoanilino)prop-1-ynyl]-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine |
| SMILES | CN1CCC(Nc2cccc3c(C(F)C(F)F)c(C#CCNc4ccc(P=O)cc4)sc23)CC1 |
| InChI | InChI=1S/C25H25F3N3OPS/c1-31-14-11-17(12-15-31)30-20-5-2-4-19-22(23(26)25(27)28)21(34-24(19)20)6-3-13-29-16-7-9-18(33-32)10-8-16/h2,4-5,7-10,17,23,25,29-30H,11-15H2,1H3 |
| InChIKey | LUUITMPKFDERQL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|