C17H20F3IN2S — CID 175558139
N-[2-iodo-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-1,3-dimethylpiperidin-4-amine (PubChem CID 175558139) has the molecular formula C17H20F3IN2S and a molecular weight of 468.33 g/mol. Its IUPAC name is N-[2-iodo-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-1,3-dimethylpiperidin-4-amine.
| Compound Name | N-[2-iodo-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-1,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 175558139 |
| Molecular Formula | C17H20F3IN2S |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | N-[2-iodo-3-(1,2,2-trifluoroethyl)-1-benzothiophen-7-yl]-1,3-dimethylpiperidin-4-amine |
| SMILES | CC1CN(C)CCC1Nc1cccc2c(C(F)C(F)F)c(I)sc12 |
| InChI | InChI=1S/C17H20F3IN2S/c1-9-8-23(2)7-6-11(9)22-12-5-3-4-10-13(14(18)16(19)20)17(21)24-15(10)12/h3-5,9,11,14,16,22H,6-8H2,1-2H3 |
| InChIKey | KXYFKVGWYZUSMZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|