C39H48F4N4O4S — CID 172535472
2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)cyclohexyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine (PubChem CID 172535472) has the molecular formula C39H48F4N4O4S and a molecular weight of 744.90 g/mol. Its IUPAC name is 2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)cyclohexyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine.
| Compound Name | 2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)cyclohexyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 172535472 |
| Molecular Formula | C39H48F4N4O4S |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | 2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)cyclohexyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine |
| SMILES | COCCOc1cc(N2CCOCC2)c(F)cc1NCC#Cc1sc2c(NC3CCC(N4CC5(CCOCC5)C4)CC3)cccc2c1CC(F)(F)F |
| InChI | InChI=1S/C39H48F4N4O4S/c1-48-20-21-51-35-23-34(46-14-18-50-19-15-46)31(40)22-33(35)44-13-3-6-36-30(24-39(41,42)43)29-4-2-5-32(37(29)52-36)45-27-7-9-28(10-8-27)47-25-38(26-47)11-16-49-17-12-38/h2,4-5,22-23,27-28,44-45H,7-21,24-26H2,1H3 |
| InChIKey | DUZMITQCSOBLDJ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|