C34H40F4N4O3S — CID 172535703
1-cyclopropyl-N-[2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine (PubChem CID 172535703) has the molecular formula C34H40F4N4O3S and a molecular weight of 660.78 g/mol. Its IUPAC name is 1-cyclopropyl-N-[2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine.
| Compound Name | 1-cyclopropyl-N-[2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 172535703 |
| Molecular Formula | C34H40F4N4O3S |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | 1-cyclopropyl-N-[2-[3-[5-fluoro-2-(2-methoxyethoxy)-4-morpholin-4-ylanilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]piperidin-4-amine |
| SMILES | COCCOc1cc(N2CCOCC2)c(F)cc1NCC#Cc1sc2c(NC3CCN(C4CC4)CC3)cccc2c1CC(F)(F)F |
| InChI | InChI=1S/C34H40F4N4O3S/c1-43-18-19-45-31-21-30(42-14-16-44-17-15-42)27(35)20-29(31)39-11-3-6-32-26(22-34(36,37)38)25-4-2-5-28(33(25)46-32)40-23-9-12-41(13-10-23)24-7-8-24/h2,4-5,20-21,23-24,39-40H,7-19,22H2,1H3 |
| InChIKey | NHIJUKAACBYBAB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|