C34H35F7N4O5S — CID 172535518
4-[[4-[[2-[3-[5-fluoro-4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)anilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]piperidin-1-yl]methyl]-1,3-dioxolan-2-one (PubChem CID 172535518) has the molecular formula C34H35F7N4O5S and a molecular weight of 744.73 g/mol. Its IUPAC name is 4-[[4-[[2-[3-[5-fluoro-4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)anilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]piperidin-1-yl]methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[[4-[[2-[3-[5-fluoro-4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)anilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]piperidin-1-yl]methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 172535518 |
| Molecular Formula | C34H35F7N4O5S |
| Molecular Weight | 744.73 g/mol |
| Exact Mass | 744.22 |
| IUPAC Name | 4-[[4-[[2-[3-[5-fluoro-4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)anilino]prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]piperidin-1-yl]methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CN2CCC(Nc3cccc4c(CC(F)(F)F)c(C#CCNc5cc(F)c(N6CCOCC6)cc5OCC(F)(F)F)sc34)CC2)O1 |
| InChI | InChI=1S/C34H35F7N4O5S/c35-25-15-27(29(49-20-34(39,40)41)16-28(25)45-11-13-47-14-12-45)42-8-2-5-30-24(17-33(36,37)38)23-3-1-4-26(31(23)51-30)43-21-6-9-44(10-7-21)18-22-19-48-32(46)50-22/h1,3-4,15-16,21-22,42-43H,6-14,17-20H2 |
| InChIKey | NHSZMCOEPQNVNX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.73 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|