C21H24F2N6OS2 — CID 172539810
6-amino-N-[2-[3-amino-4-(fluoromethyl)pyrrolidin-1-yl]-4-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 172539810) has the molecular formula C21H24F2N6OS2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 6-amino-N-[2-[3-amino-4-(fluoromethyl)pyrrolidin-1-yl]-4-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 6-amino-N-[2-[3-amino-4-(fluoromethyl)pyrrolidin-1-yl]-4-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 172539810 |
| Molecular Formula | C21H24F2N6OS2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 6-amino-N-[2-[3-amino-4-(fluoromethyl)pyrrolidin-1-yl]-4-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc2sc(C(=O)NC3CCc4nc(N5CC(N)C(CF)C5)cc(F)c4C3)c(N)c2s1 |
| InChI | InChI=1S/C21H24F2N6OS2/c1-9-26-21-19(31-9)17(25)18(32-21)20(30)27-11-2-3-15-12(4-11)13(23)5-16(28-15)29-7-10(6-22)14(24)8-29/h5,10-11,14H,2-4,6-8,24-25H2,1H3,(H,27,30) |
| InChIKey | QCTQELVDUDIMRT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |