C23H29FN6O3S2 — CID 172540335
6-amino-N-[2-[3-amino-4-(2-methoxyethoxy)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 172540335) has the molecular formula C23H29FN6O3S2 and a molecular weight of 520.66 g/mol. Its IUPAC name is 6-amino-N-[2-[3-amino-4-(2-methoxyethoxy)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 6-amino-N-[2-[3-amino-4-(2-methoxyethoxy)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 172540335 |
| Molecular Formula | C23H29FN6O3S2 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 6-amino-N-[2-[3-amino-4-(2-methoxyethoxy)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | COCCOC1CN(c2nc3c(cc2F)CC(NC(=O)c2sc4nc(C)sc4c2N)CC3)CC1N |
| InChI | InChI=1S/C23H29FN6O3S2/c1-11-27-23-20(34-11)18(26)19(35-23)22(31)28-13-3-4-16-12(7-13)8-14(24)21(29-16)30-9-15(25)17(10-30)33-6-5-32-2/h8,13,15,17H,3-7,9-10,25-26H2,1-2H3,(H,28,31) |
| InChIKey | BWCAHQGATWHVKH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|