C22H27FN6OS2 — CID 172539854
6-amino-N-[2-[3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 172539854) has the molecular formula C22H27FN6OS2 and a molecular weight of 474.63 g/mol. Its IUPAC name is 6-amino-N-[2-[3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 6-amino-N-[2-[3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 172539854 |
| Molecular Formula | C22H27FN6OS2 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 6-amino-N-[2-[3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-2-methylthieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | CNC1CN(c2ccc3c(n2)CCC(NC(=O)c2sc4nc(C)sc4c2N)C3)CC1CF |
| InChI | InChI=1S/C22H27FN6OS2/c1-11-26-22-20(31-11)18(24)19(32-22)21(30)27-14-4-5-15-12(7-14)3-6-17(28-15)29-9-13(8-23)16(10-29)25-2/h3,6,13-14,16,25H,4-5,7-10,24H2,1-2H3,(H,27,30) |
| InChIKey | AKZPXZPOMNUTQQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |