C5H8BrN3 — CID 172542091
5-bromo-2,3-dihydropyridine-2,3-diamine (PubChem CID 172542091) has the molecular formula C5H8BrN3 and a molecular weight of 190.04 g/mol. Its IUPAC name is 5-bromo-2,3-dihydropyridine-2,3-diamine.
| Compound Name | 5-bromo-2,3-dihydropyridine-2,3-diamine |
|---|---|
| PubChem CID | 172542091 |
| Molecular Formula | C5H8BrN3 |
| Molecular Weight | 190.04 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 5-bromo-2,3-dihydropyridine-2,3-diamine |
| SMILES | NC1C=C(Br)C=NC1N |
| InChI | InChI=1S/C5H8BrN3/c6-3-1-4(7)5(8)9-2-3/h1-2,4-5H,7-8H2 |
| InChIKey | BPVFPGHXTUKTSZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.04 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |