C13H14N2O4 — CID 17254256
2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-N-prop-2-enylacetamide (PubChem CID 17254256) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 17254256 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COCc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C13H14N2O4/c1-2-5-14-13(16)9-17-8-10-7-12(19-15-10)11-4-3-6-18-11/h2-4,6-7H,1,5,8-9H2,(H,14,16) |
| InChIKey | FPOWAVXOBFNJCE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|