C19H19F3N4O — CID 172543149
N-[(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl]acetamide (PubChem CID 172543149) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is N-[(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl]acetamide.
| Compound Name | N-[(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 172543149 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H]2CN(c3ccc(C(F)(F)F)cc3)c3cccnc3N2C1 |
| InChI | InChI=1S/C19H19F3N4O/c1-12(27)24-14-9-16-11-25(15-6-4-13(5-7-15)19(20,21)22)17-3-2-8-23-18(17)26(16)10-14/h2-8,14,16H,9-11H2,1H3,(H,24,27)/t14-,16+/m0/s1 |
| InChIKey | ITTWWMIHVPXHQU-GOEBONIOSA-N |
| XLogP | 3.34 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |