C21H21F3N4O — CID 172543236
cyclopropyl-[8-[4-(trifluoromethyl)phenyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]methanone (PubChem CID 172543236) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is cyclopropyl-[8-[4-(trifluoromethyl)phenyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]methanone.
| Compound Name | cyclopropyl-[8-[4-(trifluoromethyl)phenyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]methanone |
|---|---|
| PubChem CID | 172543236 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | cyclopropyl-[8-[4-(trifluoromethyl)phenyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]methanone |
| SMILES | O=C(C1CC1)N1CCN2c3ncccc3N(c3ccc(C(F)(F)F)cc3)CC2C1 |
| InChI | InChI=1S/C21H21F3N4O/c22-21(23,24)15-5-7-16(8-6-15)28-13-17-12-26(20(29)14-3-4-14)10-11-27(17)19-18(28)2-1-9-25-19/h1-2,5-9,14,17H,3-4,10-13H2 |
| InChIKey | JHDBKTNJPPSNHN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |