C19H19F3N4O2 — CID 172543309
[(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl] N-methylcarbamate (PubChem CID 172543309) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is [(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl] N-methylcarbamate.
| Compound Name | [(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 172543309 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [(4S,6R)-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-4-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@H]1C[C@@H]2CN(c3ccc(C(F)(F)F)cc3)c3cccnc3N2C1 |
| InChI | InChI=1S/C19H19F3N4O2/c1-23-18(27)28-15-9-14-10-25(13-6-4-12(5-7-13)19(20,21)22)16-3-2-8-24-17(16)26(14)11-15/h2-8,14-15H,9-11H2,1H3,(H,23,27)/t14-,15+/m1/s1 |
| InChIKey | PYEGKRCZNDDSDE-CABCVRRESA-N |
| XLogP | 3.56 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |